C24H21FN6O4S — CID 136609252
(1R,2S,7R,8S)-5-(7-azido-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione (PubChem CID 136609252) has the molecular formula C24H21FN6O4S and a molecular weight of 508.54 g/mol. Its IUPAC name is (1R,2S,7R,8S)-5-(7-azido-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione.
| Compound Name | (1R,2S,7R,8S)-5-(7-azido-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
|---|---|
| PubChem CID | 136609252 |
| Molecular Formula | C24H21FN6O4S |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | (1R,2S,7R,8S)-5-(7-azido-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
| SMILES | [N-]=[N+]=Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3N(Cc3ccc(F)cc3)C1=O)N2 |
| InChI | InChI=1S/C24H21FN6O4S/c25-15-5-1-12(2-6-15)11-31-21-14-4-3-13(9-14)19(21)22(32)20(24(31)33)23-27-17-8-7-16(28-30-26)10-18(17)36(34,35)29-23/h1-2,5-8,10,13-14,19-21H,3-4,9,11H2,(H,27,29)/t13-,14+,19+,20?,21-/m0/s1 |
| InChIKey | OLZPSSCRZROLNF-UXVKOFPZSA-N |
| XLogP | 3.92 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|