C24H23FN4O6S3 — CID 91378730
N-[[3-[3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undec-9-en-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide (PubChem CID 91378730) has the molecular formula C24H23FN4O6S3 and a molecular weight of 578.67 g/mol. Its IUPAC name is N-[[3-[3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undec-9-en-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undec-9-en-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 91378730 |
| Molecular Formula | C24H23FN4O6S3 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | N-[[3-[3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undec-9-en-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1csc2c1S(=O)(=O)N=C(C1C(=O)C3C4C=CC(C4)C3N(Cc3ccc(F)cc3)C1=O)N2 |
| InChI | InChI=1S/C24H23FN4O6S3/c1-37(32,33)26-9-15-11-36-23-21(15)38(34,35)28-22(27-23)18-20(30)17-13-4-5-14(8-13)19(17)29(24(18)31)10-12-2-6-16(25)7-3-12/h2-7,11,13-14,17-19,26H,8-10H2,1H3,(H,27,28) |
| InChIKey | DVJVDMMKGVBVIS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|