C22H22N4O6S4 — CID 135936745
N-[[3-[6-hydroxy-4-oxo-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undeca-5,9-dien-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide (PubChem CID 135936745) has the molecular formula C22H22N4O6S4 and a molecular weight of 566.71 g/mol. Its IUPAC name is N-[[3-[6-hydroxy-4-oxo-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undeca-5,9-dien-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[6-hydroxy-4-oxo-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undeca-5,9-dien-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 135936745 |
| Molecular Formula | C22H22N4O6S4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | N-[[3-[6-hydroxy-4-oxo-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undeca-5,9-dien-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1csc2c1S(=O)(=O)N=C(C1=C(O)C3C4C=CC(C4)C3N(Cc3ccsc3)C1=O)N2 |
| InChI | InChI=1S/C22H22N4O6S4/c1-35(29,30)23-7-14-10-34-21-19(14)36(31,32)25-20(24-21)16-18(27)15-12-2-3-13(6-12)17(15)26(22(16)28)8-11-4-5-33-9-11/h2-5,9-10,12-13,15,17,23,27H,6-8H2,1H3,(H,24,25) |
| InChIKey | AGUFIHJAJQXMGW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|