C29H35N5O9S2 — CID 11285283
2-[[3-[4-methyl-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]sulfamoylamino]ethyl 3-hydroxyazetidine-1-carboxylate (PubChem CID 11285283) has the molecular formula C29H35N5O9S2 and a molecular weight of 661.76 g/mol. Its IUPAC name is 2-[[3-[4-methyl-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]sulfamoylamino]ethyl 3-hydroxyazetidine-1-carboxylate.
| Compound Name | 2-[[3-[4-methyl-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]sulfamoylamino]ethyl 3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 11285283 |
| Molecular Formula | C29H35N5O9S2 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | 2-[[3-[4-methyl-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]sulfamoylamino]ethyl 3-hydroxyazetidine-1-carboxylate |
| SMILES | CC(C)CCC1(C)C(=O)C(C2=NS(=O)(=O)c3cc(NS(=O)(=O)NCCOC(=O)N4CC(O)C4)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C29H35N5O9S2/c1-17(2)10-11-29(3)21-7-5-4-6-20(21)25(36)24(26(29)37)27-31-22-9-8-18(14-23(22)44(39,40)33-27)32-45(41,42)30-12-13-43-28(38)34-15-19(35)16-34/h4-9,14,17,19,24,30,32,35H,10-13,15-16H2,1-3H3,(H,31,33) |
| InChIKey | XRDRUYHLZQZEES-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 200.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|