C25H30N6O6S2 — CID 10348105
3-[7-(cyclopentylsulfamoylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-1,8-naphthyridine-2,4-dione (PubChem CID 10348105) has the molecular formula C25H30N6O6S2 and a molecular weight of 574.69 g/mol. Its IUPAC name is 3-[7-(cyclopentylsulfamoylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-1,8-naphthyridine-2,4-dione.
| Compound Name | 3-[7-(cyclopentylsulfamoylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-1,8-naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 10348105 |
| Molecular Formula | C25H30N6O6S2 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 3-[7-(cyclopentylsulfamoylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1-(3-methylbutyl)-1,8-naphthyridine-2,4-dione |
| SMILES | CC(C)CCN1C(=O)C(C2=NS(=O)(=O)c3cc(NS(=O)(=O)NC4CCCC4)ccc3N2)C(=O)c2cccnc21 |
| InChI | InChI=1S/C25H30N6O6S2/c1-15(2)11-13-31-24-18(8-5-12-26-24)22(32)21(25(31)33)23-27-19-10-9-17(14-20(19)38(34,35)30-23)29-39(36,37)28-16-6-3-4-7-16/h5,8-10,12,14-16,21,28-29H,3-4,6-7,11,13H2,1-2H3,(H,27,30) |
| InChIKey | JNLMRMJWCNTUAL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|