C17H21N5O6S2 — CID 10343986
3-[1-(3-methylbutyl)-2,4-dioxo-3-pyridinyl]-1,1-dioxo-7-(sulfamoylamino)-4H-1λ6,2,4-benzothiadiazine (PubChem CID 10343986) has the molecular formula C17H21N5O6S2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 3-[1-(3-methylbutyl)-2,4-dioxo-3-pyridinyl]-1,1-dioxo-7-(sulfamoylamino)-4H-1λ6,2,4-benzothiadiazine.
| Compound Name | 3-[1-(3-methylbutyl)-2,4-dioxo-3-pyridinyl]-1,1-dioxo-7-(sulfamoylamino)-4H-1λ6,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 10343986 |
| Molecular Formula | C17H21N5O6S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 3-[1-(3-methylbutyl)-2,4-dioxo-3-pyridinyl]-1,1-dioxo-7-(sulfamoylamino)-4H-1λ6,2,4-benzothiadiazine |
| SMILES | CC(C)CCN1C=CC(=O)C(C2=NS(=O)(=O)c3cc(NS(N)(=O)=O)ccc3N2)C1=O |
| InChI | InChI=1S/C17H21N5O6S2/c1-10(2)5-7-22-8-6-13(23)15(17(22)24)16-19-12-4-3-11(20-30(18,27)28)9-14(12)29(25,26)21-16/h3-4,6,8-10,15,20H,5,7H2,1-2H3,(H,19,21)(H2,18,27,28) |
| InChIKey | KXXVKNMYALIDCR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|