C21H24N6O6S2 — CID 11756432
1-(3-methylbutyl)-3-[7-(methylsulfamoylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1,8-naphthyridine-2,4-dione (PubChem CID 11756432) has the molecular formula C21H24N6O6S2 and a molecular weight of 520.59 g/mol. Its IUPAC name is 1-(3-methylbutyl)-3-[7-(methylsulfamoylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1,8-naphthyridine-2,4-dione.
| Compound Name | 1-(3-methylbutyl)-3-[7-(methylsulfamoylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1,8-naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 11756432 |
| Molecular Formula | C21H24N6O6S2 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 1-(3-methylbutyl)-3-[7-(methylsulfamoylamino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl]-1,8-naphthyridine-2,4-dione |
| SMILES | CNS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N=C(C1C(=O)c3cccnc3N(CCC(C)C)C1=O)N2 |
| InChI | InChI=1S/C21H24N6O6S2/c1-12(2)8-10-27-20-14(5-4-9-23-20)18(28)17(21(27)29)19-24-15-7-6-13(25-35(32,33)22-3)11-16(15)34(30,31)26-19/h4-7,9,11-12,17,22,25H,8,10H2,1-3H3,(H,24,26) |
| InChIKey | RCPWWXZBXDBLJD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|