C25H24N6O8S2 — CID 10054308
methyl 6-[3-[1-(3-methylbutyl)-2,4-dioxo-1,8-naphthyridin-3-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-6-yl]-1,1-dioxo-1,2,5-thiadiazine-2-carboxylate (PubChem CID 10054308) has the molecular formula C25H24N6O8S2 and a molecular weight of 600.64 g/mol. Its IUPAC name is methyl 6-[3-[1-(3-methylbutyl)-2,4-dioxo-1,8-naphthyridin-3-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-6-yl]-1,1-dioxo-1,2,5-thiadiazine-2-carboxylate.
| Compound Name | methyl 6-[3-[1-(3-methylbutyl)-2,4-dioxo-1,8-naphthyridin-3-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-6-yl]-1,1-dioxo-1,2,5-thiadiazine-2-carboxylate |
|---|---|
| PubChem CID | 10054308 |
| Molecular Formula | C25H24N6O8S2 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | methyl 6-[3-[1-(3-methylbutyl)-2,4-dioxo-1,8-naphthyridin-3-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-6-yl]-1,1-dioxo-1,2,5-thiadiazine-2-carboxylate |
| SMILES | COC(=O)N1C=CN=C(c2ccc3c(c2)NC(C2C(=O)c4cccnc4N(CCC(C)C)C2=O)=NS3(=O)=O)S1(=O)=O |
| InChI | InChI=1S/C25H24N6O8S2/c1-14(2)8-11-30-22-16(5-4-9-26-22)20(32)19(24(30)33)21-28-17-13-15(6-7-18(17)40(35,36)29-21)23-27-10-12-31(25(34)39-3)41(23,37)38/h4-7,9-10,12-14,19H,8,11H2,1-3H3,(H,28,29) |
| InChIKey | QUCFUWOHJSMXRQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|