C24H23N5O5S — CID 10141373
2-[[5-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-(3-methylbutyl)-2,4,6-trioxo-1,3-diazinan-1-yl]methyl]benzonitrile (PubChem CID 10141373) has the molecular formula C24H23N5O5S and a molecular weight of 493.55 g/mol. Its IUPAC name is 2-[[5-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-(3-methylbutyl)-2,4,6-trioxo-1,3-diazinan-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[5-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-(3-methylbutyl)-2,4,6-trioxo-1,3-diazinan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 10141373 |
| Molecular Formula | C24H23N5O5S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-[[5-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-(3-methylbutyl)-2,4,6-trioxo-1,3-diazinan-1-yl]methyl]benzonitrile |
| SMILES | CC(C)CCN1C(=O)C(C2=NS(=O)(=O)c3ccccc3N2)C(=O)N(Cc2ccccc2C#N)C1=O |
| InChI | InChI=1S/C24H23N5O5S/c1-15(2)11-12-28-22(30)20(21-26-18-9-5-6-10-19(18)35(33,34)27-21)23(31)29(24(28)32)14-17-8-4-3-7-16(17)13-25/h3-10,15,20H,11-12,14H2,1-2H3,(H,26,27) |
| InChIKey | WESJMHFQPABEAC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 140.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|