C22H29N3O4S — CID 11743485
(5S)-5-cyclohexyl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)pyrrolidine-2,4-dione (PubChem CID 11743485) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is (5S)-5-cyclohexyl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)pyrrolidine-2,4-dione.
| Compound Name | (5S)-5-cyclohexyl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 11743485 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (5S)-5-cyclohexyl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(3-methylbutyl)pyrrolidine-2,4-dione |
| SMILES | CC(C)CCN1C(=O)C(C2=NS(=O)(=O)c3ccccc3N2)C(=O)[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C22H29N3O4S/c1-14(2)12-13-25-19(15-8-4-3-5-9-15)20(26)18(22(25)27)21-23-16-10-6-7-11-17(16)30(28,29)24-21/h6-7,10-11,14-15,18-19H,3-5,8-9,12-13H2,1-2H3,(H,23,24)/t18?,19-/m0/s1 |
| InChIKey | GGQOCTSLSISLHN-GGYWPGCISA-N |
| XLogP | 3.22 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|