C26H34N4O4S — CID 91202685
(1R,2S,7R,8S)-5-(1,1-dioxo-7-pyrrolidin-1-yl-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-(3-methylbutyl)-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione (PubChem CID 91202685) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is (1R,2S,7R,8S)-5-(1,1-dioxo-7-pyrrolidin-1-yl-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-(3-methylbutyl)-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione.
| Compound Name | (1R,2S,7R,8S)-5-(1,1-dioxo-7-pyrrolidin-1-yl-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-(3-methylbutyl)-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
|---|---|
| PubChem CID | 91202685 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | (1R,2S,7R,8S)-5-(1,1-dioxo-7-pyrrolidin-1-yl-4H-1λ6,2,4-benzothiadiazin-3-yl)-3-(3-methylbutyl)-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
| SMILES | CC(C)CCN1C(=O)C(C2=NS(=O)(=O)c3cc(N4CCCC4)ccc3N2)C(=O)[C@@H]2[C@H]3CC[C@H](C3)[C@@H]21 |
| InChI | InChI=1S/C26H34N4O4S/c1-15(2)9-12-30-23-17-6-5-16(13-17)21(23)24(31)22(26(30)32)25-27-19-8-7-18(29-10-3-4-11-29)14-20(19)35(33,34)28-25/h7-8,14-17,21-23H,3-6,9-13H2,1-2H3,(H,27,28)/t16-,17+,21+,22?,23-/m0/s1 |
| InChIKey | NDTVRLFAMXUIJA-SEKCUYLTSA-N |
| XLogP | 3.29 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|