C22H23N3O4S — CID 10048053
(5S)-1-benzyl-5-butan-2-yl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)pyrrolidine-2,4-dione (PubChem CID 10048053) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is (5S)-1-benzyl-5-butan-2-yl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)pyrrolidine-2,4-dione.
| Compound Name | (5S)-1-benzyl-5-butan-2-yl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 10048053 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (5S)-1-benzyl-5-butan-2-yl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)pyrrolidine-2,4-dione |
| SMILES | CCC(C)[C@H]1C(=O)C(C2=NS(=O)(=O)c3ccccc3N2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-3-14(2)19-20(26)18(22(27)25(19)13-15-9-5-4-6-10-15)21-23-16-11-7-8-12-17(16)30(28,29)24-21/h4-12,14,18-19H,3,13H2,1-2H3,(H,23,24)/t14?,18?,19-/m0/s1 |
| InChIKey | WUQBLMPADJJIFK-FPCQFERPSA-N |
| XLogP | 2.84 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|