C23H24N2O4S — CID 11154481
2-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-dipropylnaphthalene-1,3-dione (PubChem CID 11154481) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-dipropylnaphthalene-1,3-dione.
| Compound Name | 2-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-dipropylnaphthalene-1,3-dione |
|---|---|
| PubChem CID | 11154481 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-dipropylnaphthalene-1,3-dione |
| SMILES | CCCC1(CCC)C(=O)C(C2=NS(=O)(=O)c3ccccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C23H24N2O4S/c1-3-13-23(14-4-2)16-10-6-5-9-15(16)20(26)19(21(23)27)22-24-17-11-7-8-12-18(17)30(28,29)25-22/h5-12,19H,3-4,13-14H2,1-2H3,(H,24,25) |
| InChIKey | SKXUJMRNQMZAFS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|