C23H24N2O5S — CID 11396535
2-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-dipropylnaphthalene-1,3-dione (PubChem CID 11396535) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 2-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-dipropylnaphthalene-1,3-dione.
| Compound Name | 2-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-dipropylnaphthalene-1,3-dione |
|---|---|
| PubChem CID | 11396535 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4,4-dipropylnaphthalene-1,3-dione |
| SMILES | CCCC1(CCC)C(=O)C(C2=NS(=O)(=O)c3cc(O)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C23H24N2O5S/c1-3-11-23(12-4-2)16-8-6-5-7-15(16)20(27)19(21(23)28)22-24-17-10-9-14(26)13-18(17)31(29,30)25-22/h5-10,13,19,26H,3-4,11-12H2,1-2H3,(H,24,25) |
| InChIKey | AKMNBICMMDVGHE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|