C22H16FN3O4S2 — CID 10004872
(5S)-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-5-(4-fluorophenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,4-dione (PubChem CID 10004872) has the molecular formula C22H16FN3O4S2 and a molecular weight of 469.52 g/mol. Its IUPAC name is (5S)-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-5-(4-fluorophenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,4-dione.
| Compound Name | (5S)-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-5-(4-fluorophenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 10004872 |
| Molecular Formula | C22H16FN3O4S2 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (5S)-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-5-(4-fluorophenyl)-1-(thiophen-2-ylmethyl)pyrrolidine-2,4-dione |
| SMILES | O=C1C(C2=NS(=O)(=O)c3ccccc3N2)C(=O)N(Cc2cccs2)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16FN3O4S2/c23-14-9-7-13(8-10-14)19-20(27)18(22(28)26(19)12-15-4-3-11-31-15)21-24-16-5-1-2-6-17(16)32(29,30)25-21/h1-11,18-19H,12H2,(H,24,25)/t18?,19-/m0/s1 |
| InChIKey | OMQZCPUENOZBSG-GGYWPGCISA-N |
| XLogP | 3.37 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|