C20H14ClN5O4S2 — CID 10254911
1-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)quinoline-2,4-dione (PubChem CID 10254911) has the molecular formula C20H14ClN5O4S2 and a molecular weight of 487.95 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)quinoline-2,4-dione.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)quinoline-2,4-dione |
|---|---|
| PubChem CID | 10254911 |
| Molecular Formula | C20H14ClN5O4S2 |
| Molecular Weight | 487.95 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methylamino]-3-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)quinoline-2,4-dione |
| SMILES | O=C1c2ccccc2N(NCc2cnc(Cl)s2)C(=O)C1C1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C20H14ClN5O4S2/c21-20-22-9-11(31-20)10-23-26-14-7-3-1-5-12(14)17(27)16(19(26)28)18-24-13-6-2-4-8-15(13)32(29,30)25-18/h1-9,16,23H,10H2,(H,24,25) |
| InChIKey | XWFQFMSKYUEDOK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.95 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|