C19H14N4O4S3 — CID 10479292
6-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(thiophen-3-ylmethylamino)thieno[3,2-b]pyridine-5,7-dione (PubChem CID 10479292) has the molecular formula C19H14N4O4S3 and a molecular weight of 458.55 g/mol. Its IUPAC name is 6-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(thiophen-3-ylmethylamino)thieno[3,2-b]pyridine-5,7-dione.
| Compound Name | 6-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(thiophen-3-ylmethylamino)thieno[3,2-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 10479292 |
| Molecular Formula | C19H14N4O4S3 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 6-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-(thiophen-3-ylmethylamino)thieno[3,2-b]pyridine-5,7-dione |
| SMILES | O=C1c2sccc2N(NCc2ccsc2)C(=O)C1C1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C19H14N4O4S3/c24-16-15(18-21-12-3-1-2-4-14(12)30(26,27)22-18)19(25)23(13-6-8-29-17(13)16)20-9-11-5-7-28-10-11/h1-8,10,15,20H,9H2,(H,21,22) |
| InChIKey | DNUFODVRHPSKSE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|