C18H19N5O4S2 — CID 10025872
(5S)-5-butan-2-yl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(thiadiazol-4-ylmethyl)pyrrolidine-2,4-dione (PubChem CID 10025872) has the molecular formula C18H19N5O4S2 and a molecular weight of 433.52 g/mol. Its IUPAC name is (5S)-5-butan-2-yl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(thiadiazol-4-ylmethyl)pyrrolidine-2,4-dione.
| Compound Name | (5S)-5-butan-2-yl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(thiadiazol-4-ylmethyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 10025872 |
| Molecular Formula | C18H19N5O4S2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (5S)-5-butan-2-yl-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-1-(thiadiazol-4-ylmethyl)pyrrolidine-2,4-dione |
| SMILES | CCC(C)[C@H]1C(=O)C(C2=NS(=O)(=O)c3ccccc3N2)C(=O)N1Cc1csnn1 |
| InChI | InChI=1S/C18H19N5O4S2/c1-3-10(2)15-16(24)14(18(25)23(15)8-11-9-28-22-20-11)17-19-12-6-4-5-7-13(12)29(26,27)21-17/h4-7,9-10,14-15H,3,8H2,1-2H3,(H,19,21)/t10?,14?,15-/m0/s1 |
| InChIKey | BJBCGLLITHBTBY-XWFMALBVSA-N |
| XLogP | 1.69 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|