C14H13ClN4O2S — CID 168583817
3-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 168583817) has the molecular formula C14H13ClN4O2S and a molecular weight of 336.80 g/mol. Its IUPAC name is 3-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 168583817 |
| Molecular Formula | C14H13ClN4O2S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 3-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1NC(=O)N(c2ccccc2NCc2cnc(Cl)s2)C1=O |
| InChI | InChI=1S/C14H13ClN4O2S/c1-8-12(20)19(14(21)18-8)11-5-3-2-4-10(11)16-6-9-7-17-13(15)22-9/h2-5,7-8,16H,6H2,1H3,(H,18,21) |
| InChIKey | VORLVXNZUPUAIO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|