C15H18ClN3OS — CID 168580176
1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol (PubChem CID 168580176) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol.
| Compound Name | 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 168580176 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol |
| SMILES | OC1CCN(c2ccccc2NCc2cnc(Cl)s2)CC1 |
| InChI | InChI=1S/C15H18ClN3OS/c16-15-18-10-12(21-15)9-17-13-3-1-2-4-14(13)19-7-5-11(20)6-8-19/h1-4,10-11,17,20H,5-9H2 |
| InChIKey | CXRGYFMDMJXDDA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |