About 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol
1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol (PubChem CID 168580176) has the molecular formula C15H18ClN3OS
and a molecular weight of 323.85 g/mol. Its IUPAC name is 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol |
| PubChem CID | 168580176 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol |
| SMILES | OC1CCN(c2ccccc2NCc2cnc(Cl)s2)CC1 |
| InChI | InChI=1S/C15H18ClN3OS/c16-15-18-10-12(21-15)9-17-13-3-1-2-4-14(13)19-7-5-11(20)6-8-19/h1-4,10-11,17,20H,5-9H2 |
| InChIKey | CXRGYFMDMJXDDA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol?
The IUPAC name of 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol (CID 168580176) is 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol.
What is the SMILES notation for 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol?
The canonical SMILES for 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol is OC1CCN(c2ccccc2NCc2cnc(Cl)s2)CC1.
What is the InChIKey of 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol?
The InChIKey is CXRGYFMDMJXDDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3OS/c16-15-18-10-12(21-15)9-17-13-3-1-2-4-14(13)19-7-5-11(20)6-8-19/h1-4,10-11,17,20H,5-9H2.
What are the key properties of 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol?
1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol has a molecular weight of 323.85 g/mol, XLogP of 3.37, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]piperidin-4-ol is sourced from PubChem (CID 168580176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).