C36H33N3O6 — CID 142665261
N-[2-[[2-[4-methoxy-3-(4-phenylbutan-2-yloxy)phenyl]-3-oxo-1H-isoindol-5-yl]methyl]-1,3-dioxoisoindol-5-yl]acetamide (PubChem CID 142665261) has the molecular formula C36H33N3O6 and a molecular weight of 603.68 g/mol. Its IUPAC name is N-[2-[[2-[4-methoxy-3-(4-phenylbutan-2-yloxy)phenyl]-3-oxo-1H-isoindol-5-yl]methyl]-1,3-dioxoisoindol-5-yl]acetamide.
| Compound Name | N-[2-[[2-[4-methoxy-3-(4-phenylbutan-2-yloxy)phenyl]-3-oxo-1H-isoindol-5-yl]methyl]-1,3-dioxoisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 142665261 |
| Molecular Formula | C36H33N3O6 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | N-[2-[[2-[4-methoxy-3-(4-phenylbutan-2-yloxy)phenyl]-3-oxo-1H-isoindol-5-yl]methyl]-1,3-dioxoisoindol-5-yl]acetamide |
| SMILES | COc1ccc(N2Cc3ccc(CN4C(=O)c5ccc(NC(C)=O)cc5C4=O)cc3C2=O)cc1OC(C)CCc1ccccc1 |
| InChI | InChI=1S/C36H33N3O6/c1-22(9-10-24-7-5-4-6-8-24)45-33-19-28(14-16-32(33)44-3)38-21-26-12-11-25(17-30(26)35(38)42)20-39-34(41)29-15-13-27(37-23(2)40)18-31(29)36(39)43/h4-8,11-19,22H,9-10,20-21H2,1-3H3,(H,37,40) |
| InChIKey | JDQRKTJSPWMMGI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|