C21H24N2O3 — CID 142666171
(3-benzyl-2-oxo-1,3,4,5-tetrahydro-1,4-benzodiazepin-7-yl) 2,2-dimethylpropanoate (PubChem CID 142666171) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (3-benzyl-2-oxo-1,3,4,5-tetrahydro-1,4-benzodiazepin-7-yl) 2,2-dimethylpropanoate.
| Compound Name | (3-benzyl-2-oxo-1,3,4,5-tetrahydro-1,4-benzodiazepin-7-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 142666171 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3-benzyl-2-oxo-1,3,4,5-tetrahydro-1,4-benzodiazepin-7-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)CNC(Cc1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C21H24N2O3/c1-21(2,3)20(25)26-16-9-10-17-15(12-16)13-22-18(19(24)23-17)11-14-7-5-4-6-8-14/h4-10,12,18,22H,11,13H2,1-3H3,(H,23,24) |
| InChIKey | GIOKNYOZTQTKCT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|