About (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea
(2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea (PubChem CID 142666830) has the molecular formula C7H6Cl2N2OS
and a molecular weight of 237.11 g/mol. Its IUPAC name is (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea.
Molecular Properties
| Compound Name | (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
| PubChem CID | 142666830 |
| Molecular Formula | C7H6Cl2N2OS |
| Molecular Weight | 237.11 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
| SMILES | NC(=O)NC1C(=S)C=C(Cl)C=C1Cl |
| InChI | InChI=1S/C7H6Cl2N2OS/c8-3-1-4(9)6(5(13)2-3)11-7(10)12/h1-2,6H,(H3,10,11,12) |
| InChIKey | ONBIWBILAOYJPO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.11 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
The IUPAC name of (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea (CID 142666830) is (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea.
What is the SMILES notation for (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
The canonical SMILES for (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea is NC(=O)NC1C(=S)C=C(Cl)C=C1Cl.
What is the InChIKey of (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
The InChIKey is ONBIWBILAOYJPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N2OS/c8-3-1-4(9)6(5(13)2-3)11-7(10)12/h1-2,6H,(H3,10,11,12).
What are the key properties of (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
(2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea has a molecular weight of 237.11 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea is sourced from PubChem (CID 142666830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).