C7H7ClN2OS — CID 142666829
(3-chloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea (PubChem CID 142666829) has the molecular formula C7H7ClN2OS and a molecular weight of 202.67 g/mol. Its IUPAC name is (3-chloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea.
| Compound Name | (3-chloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
|---|---|
| PubChem CID | 142666829 |
| Molecular Formula | C7H7ClN2OS |
| Molecular Weight | 202.67 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | (3-chloro-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
| SMILES | NC(=O)NC1C=C(Cl)C=CC1=S |
| InChI | InChI=1S/C7H7ClN2OS/c8-4-1-2-6(12)5(3-4)10-7(9)11/h1-3,5H,(H3,9,10,11) |
| InChIKey | SPJGHYFPRMXJPS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.67 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|