About (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea
(2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea (PubChem CID 142666831) has the molecular formula C7H7BrN2OS
and a molecular weight of 247.12 g/mol. Its IUPAC name is (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea.
Molecular Properties
| Compound Name | (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
| PubChem CID | 142666831 |
| Molecular Formula | C7H7BrN2OS |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
| SMILES | NC(=O)NC1C(=S)C=CC=C1Br |
| InChI | InChI=1S/C7H7BrN2OS/c8-4-2-1-3-5(12)6(4)10-7(9)11/h1-3,6H,(H3,9,10,11) |
| InChIKey | IWGJOKQHHHAEPC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
The IUPAC name of (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea (CID 142666831) is (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea.
What is the SMILES notation for (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
The canonical SMILES for (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea is NC(=O)NC1C(=S)C=CC=C1Br.
What is the InChIKey of (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
The InChIKey is IWGJOKQHHHAEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2OS/c8-4-2-1-3-5(12)6(4)10-7(9)11/h1-3,6H,(H3,9,10,11).
What are the key properties of (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea?
(2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea has a molecular weight of 247.12 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea is sourced from PubChem (CID 142666831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).