C9H12N2OS — CID 142666845
(3-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea (PubChem CID 142666845) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is (3-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea.
| Compound Name | (3-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
|---|---|
| PubChem CID | 142666845 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3-ethyl-6-sulfanylidenecyclohexa-2,4-dien-1-yl)urea |
| SMILES | CCC1=CC(NC(N)=O)C(=S)C=C1 |
| InChI | InChI=1S/C9H12N2OS/c1-2-6-3-4-8(13)7(5-6)11-9(10)12/h3-5,7H,2H2,1H3,(H3,10,11,12) |
| InChIKey | UQXBYTVBZKGKOV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|