C15H19BrO5 — CID 142667360
2-[4-(2-bromo-3-butoxy-3-oxopropylidene)cyclohexa-1,5-dien-1-yl]oxyacetic acid (PubChem CID 142667360) has the molecular formula C15H19BrO5 and a molecular weight of 359.22 g/mol. Its IUPAC name is 2-[4-(2-bromo-3-butoxy-3-oxopropylidene)cyclohexa-1,5-dien-1-yl]oxyacetic acid.
| Compound Name | 2-[4-(2-bromo-3-butoxy-3-oxopropylidene)cyclohexa-1,5-dien-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 142667360 |
| Molecular Formula | C15H19BrO5 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-[4-(2-bromo-3-butoxy-3-oxopropylidene)cyclohexa-1,5-dien-1-yl]oxyacetic acid |
| SMILES | CCCCOC(=O)C(Br)C=C1C=CC(OCC(=O)O)=CC1 |
| InChI | InChI=1S/C15H19BrO5/c1-2-3-8-20-15(19)13(16)9-11-4-6-12(7-5-11)21-10-14(17)18/h4,6-7,9,13H,2-3,5,8,10H2,1H3,(H,17,18) |
| InChIKey | BNTBUUXEXFWHEW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|