C23H43NO — CID 142667491
(3S)-1-octadeca-1,3-dien-9-ylpiperidin-3-ol (PubChem CID 142667491) has the molecular formula C23H43NO and a molecular weight of 349.60 g/mol. Its IUPAC name is (3S)-1-octadeca-1,3-dien-9-ylpiperidin-3-ol.
| Compound Name | (3S)-1-octadeca-1,3-dien-9-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 142667491 |
| Molecular Formula | C23H43NO |
| Molecular Weight | 349.60 g/mol |
| Exact Mass | 349.33 |
| IUPAC Name | (3S)-1-octadeca-1,3-dien-9-ylpiperidin-3-ol |
| SMILES | C=CC=CCCCCC(CCCCCCCCC)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C23H43NO/c1-3-5-7-9-11-13-15-18-22(17-14-12-10-8-6-4-2)24-20-16-19-23(25)21-24/h4,6,8,22-23,25H,2-3,5,7,9-21H2,1H3/t22?,23-/m0/s1 |
| InChIKey | OFVJQUJRKLHTOU-WCSIJFPASA-N |
| XLogP | 6.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|