C17H14O3 — CID 142668503
11-(4-hydroxybutyl)-14-oxatetracyclo[6.5.1.02,7.09,13]tetradeca-1(13),2,4,6,8,11-hexaen-10-one (PubChem CID 142668503) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 11-(4-hydroxybutyl)-14-oxatetracyclo[6.5.1.02,7.09,13]tetradeca-1(13),2,4,6,8,11-hexaen-10-one.
| Compound Name | 11-(4-hydroxybutyl)-14-oxatetracyclo[6.5.1.02,7.09,13]tetradeca-1(13),2,4,6,8,11-hexaen-10-one |
|---|---|
| PubChem CID | 142668503 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 11-(4-hydroxybutyl)-14-oxatetracyclo[6.5.1.02,7.09,13]tetradeca-1(13),2,4,6,8,11-hexaen-10-one |
| SMILES | O=C1C(CCCCO)=Cc2c1c1oc2c2ccccc12 |
| InChI | InChI=1S/C17H14O3/c18-8-4-3-5-10-9-13-14(15(10)19)17-12-7-2-1-6-11(12)16(13)20-17/h1-2,6-7,9,18H,3-5,8H2 |
| InChIKey | CZZRMCZZKWKZDA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|