C27H29N7O7 — CID 142671634
N-[[(5S)-3-[4-[4-(2,6-dimethoxypyrimidin-4-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-nitrobenzamide (PubChem CID 142671634) has the molecular formula C27H29N7O7 and a molecular weight of 563.57 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-(2,6-dimethoxypyrimidin-4-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-nitrobenzamide.
| Compound Name | N-[[(5S)-3-[4-[4-(2,6-dimethoxypyrimidin-4-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 142671634 |
| Molecular Formula | C27H29N7O7 |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | N-[[(5S)-3-[4-[4-(2,6-dimethoxypyrimidin-4-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-nitrobenzamide |
| SMILES | COc1cc(N2CCN(c3ccc(N4C[C@H](CNC(=O)c5cccc([N+](=O)[O-])c5)OC4=O)cc3)CC2)nc(OC)n1 |
| InChI | InChI=1S/C27H29N7O7/c1-39-24-15-23(29-26(30-24)40-2)32-12-10-31(11-13-32)19-6-8-20(9-7-19)33-17-22(41-27(33)36)16-28-25(35)18-4-3-5-21(14-18)34(37)38/h3-9,14-15,22H,10-13,16-17H2,1-2H3,(H,28,35)/t22-/m0/s1 |
| InChIKey | FUYJFKRXDSQLNK-QFIPXVFZSA-N |
| XLogP | 2.48 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|