C26H25N7O7 — CID 142671664
3-nitro-N-[[(5S)-3-[4-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]benzamide (PubChem CID 142671664) has the molecular formula C26H25N7O7 and a molecular weight of 547.53 g/mol. Its IUPAC name is 3-nitro-N-[[(5S)-3-[4-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]benzamide.
| Compound Name | 3-nitro-N-[[(5S)-3-[4-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 142671664 |
| Molecular Formula | C26H25N7O7 |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 3-nitro-N-[[(5S)-3-[4-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]benzamide |
| SMILES | O=C(NC[C@H]1CN(c2ccc(N3CCN(c4ccc([N+](=O)[O-])cn4)CC3)cc2)C(=O)O1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H25N7O7/c34-25(18-2-1-3-21(14-18)32(36)37)28-16-23-17-31(26(35)40-23)20-6-4-19(5-7-20)29-10-12-30(13-11-29)24-9-8-22(15-27-24)33(38)39/h1-9,14-15,23H,10-13,16-17H2,(H,28,34)/t23-/m0/s1 |
| InChIKey | KFMLJAVGJNAXJX-QHCPKHFHSA-N |
| XLogP | 2.98 |
| TPSA | 164.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|