C19H18F3N5O4 — CID 27809919
3-nitro-N-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]benzamide (PubChem CID 27809919) has the molecular formula C19H18F3N5O4 and a molecular weight of 437.38 g/mol. Its IUPAC name is 3-nitro-N-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | 3-nitro-N-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 27809919 |
| Molecular Formula | C19H18F3N5O4 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-nitro-N-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCN(c2ccc(C(F)(F)F)cn2)CC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18F3N5O4/c20-19(21,22)14-4-5-16(23-11-14)25-6-8-26(9-7-25)17(28)12-24-18(29)13-2-1-3-15(10-13)27(30)31/h1-5,10-11H,6-9,12H2,(H,24,29) |
| InChIKey | QKTHFONLOPGGIK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|