C18H20N5O4+ — CID 7974769
3-nitro-N-[2-oxo-2-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethyl]benzamide (PubChem CID 7974769) has the molecular formula C18H20N5O4+ and a molecular weight of 370.39 g/mol. Its IUPAC name is 3-nitro-N-[2-oxo-2-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 3-nitro-N-[2-oxo-2-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 7974769 |
| Molecular Formula | C18H20N5O4+ |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-nitro-N-[2-oxo-2-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCN(c2cccc[nH+]2)CC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N5O4/c24-17(13-20-18(25)14-4-3-5-15(12-14)23(26)27)22-10-8-21(9-11-22)16-6-1-2-7-19-16/h1-7,12H,8-11,13H2,(H,20,25)/p+1 |
| InChIKey | FLZIQKNRQOQAMX-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|