C27H23F3N4O5 — CID 59559663
4-(3-nitrophenyl)-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]benzamide (PubChem CID 59559663) has the molecular formula C27H23F3N4O5 and a molecular weight of 540.50 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | 4-(3-nitrophenyl)-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 59559663 |
| Molecular Formula | C27H23F3N4O5 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 4-(3-nitrophenyl)-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCN(C(=O)c2ccccc2C(F)(F)F)CC1)c1ccc(-c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C27H23F3N4O5/c28-27(29,30)23-7-2-1-6-22(23)26(37)33-14-12-32(13-15-33)24(35)17-31-25(36)19-10-8-18(9-11-19)20-4-3-5-21(16-20)34(38)39/h1-11,16H,12-15,17H2,(H,31,36) |
| InChIKey | JKFCIOVHFAWSDK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|