C19H17F3N4O6 — CID 25164721
5-nitro-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]furan-2-carboxamide (PubChem CID 25164721) has the molecular formula C19H17F3N4O6 and a molecular weight of 454.36 g/mol. Its IUPAC name is 5-nitro-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]furan-2-carboxamide.
| Compound Name | 5-nitro-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25164721 |
| Molecular Formula | C19H17F3N4O6 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 5-nitro-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCC(=O)N1CCN(C(=O)c2ccccc2C(F)(F)F)CC1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C19H17F3N4O6/c20-19(21,22)13-4-2-1-3-12(13)18(29)25-9-7-24(8-10-25)15(27)11-23-17(28)14-5-6-16(32-14)26(30)31/h1-6H,7-11H2,(H,23,28) |
| InChIKey | DPDJCBLCMOAKPJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|