C19H19F3N4O6 — CID 71044865
5-nitro-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]-2,3-dihydrofuran-2-carboxamide (PubChem CID 71044865) has the molecular formula C19H19F3N4O6 and a molecular weight of 456.38 g/mol. Its IUPAC name is 5-nitro-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]-2,3-dihydrofuran-2-carboxamide.
| Compound Name | 5-nitro-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]-2,3-dihydrofuran-2-carboxamide |
|---|---|
| PubChem CID | 71044865 |
| Molecular Formula | C19H19F3N4O6 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 5-nitro-N-[2-oxo-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]ethyl]-2,3-dihydrofuran-2-carboxamide |
| SMILES | O=C(NCC(=O)N1CCN(C(=O)c2ccccc2C(F)(F)F)CC1)C1CC=C([N+](=O)[O-])O1 |
| InChI | InChI=1S/C19H19F3N4O6/c20-19(21,22)13-4-2-1-3-12(13)18(29)25-9-7-24(8-10-25)15(27)11-23-17(28)14-5-6-16(32-14)26(30)31/h1-4,6,14H,5,7-11H2,(H,23,28) |
| InChIKey | LQQFQDYSKFDDBA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|