C16H18N5O3+ — CID 7470040
N-(3-nitrophenyl)-4-pyridin-1-ium-2-ylpiperazine-1-carboxamide (PubChem CID 7470040) has the molecular formula C16H18N5O3+ and a molecular weight of 328.35 g/mol. Its IUPAC name is N-(3-nitrophenyl)-4-pyridin-1-ium-2-ylpiperazine-1-carboxamide.
| Compound Name | N-(3-nitrophenyl)-4-pyridin-1-ium-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 7470040 |
| Molecular Formula | C16H18N5O3+ |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-(3-nitrophenyl)-4-pyridin-1-ium-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)N1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C16H17N5O3/c22-16(18-13-4-3-5-14(12-13)21(23)24)20-10-8-19(9-11-20)15-6-1-2-7-17-15/h1-7,12H,8-11H2,(H,18,22)/p+1 |
| InChIKey | UJPYIEHELIFEGT-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|