C23H25FN4O5 — CID 55848032
N-[2-(2-fluorophenyl)ethyl]-1-[2-[(3-nitrobenzoyl)amino]acetyl]piperidine-4-carboxamide (PubChem CID 55848032) has the molecular formula C23H25FN4O5 and a molecular weight of 456.47 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-1-[2-[(3-nitrobenzoyl)amino]acetyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-1-[2-[(3-nitrobenzoyl)amino]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55848032 |
| Molecular Formula | C23H25FN4O5 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-1-[2-[(3-nitrobenzoyl)amino]acetyl]piperidine-4-carboxamide |
| SMILES | O=C(NCC(=O)N1CCC(C(=O)NCCc2ccccc2F)CC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25FN4O5/c24-20-7-2-1-4-16(20)8-11-25-22(30)17-9-12-27(13-10-17)21(29)15-26-23(31)18-5-3-6-19(14-18)28(32)33/h1-7,14,17H,8-13,15H2,(H,25,30)(H,26,31) |
| InChIKey | JUGHMJVPUFSVGA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|