C29H30FN3O3 — CID 55963689
1-(2-benzamido-2-phenylacetyl)-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide (PubChem CID 55963689) has the molecular formula C29H30FN3O3 and a molecular weight of 487.58 g/mol. Its IUPAC name is 1-(2-benzamido-2-phenylacetyl)-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-benzamido-2-phenylacetyl)-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55963689 |
| Molecular Formula | C29H30FN3O3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-(2-benzamido-2-phenylacetyl)-N-[2-(2-fluorophenyl)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NC(C(=O)N1CCC(C(=O)NCCc2ccccc2F)CC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H30FN3O3/c30-25-14-8-7-9-21(25)15-18-31-27(34)24-16-19-33(20-17-24)29(36)26(22-10-3-1-4-11-22)32-28(35)23-12-5-2-6-13-23/h1-14,24,26H,15-20H2,(H,31,34)(H,32,35) |
| InChIKey | CXTJGMVZDWCCET-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |