C39H61N3O7SSi — CID 142672256
methyl 3-[[(2R,4S,5S)-5-[[3-[benzylsulfonyl(methyl)amino]benzoyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethyloctanoyl]amino]cyclohexane-1-carboxylate (PubChem CID 142672256) has the molecular formula C39H61N3O7SSi and a molecular weight of 744.08 g/mol. Its IUPAC name is methyl 3-[[(2R,4S,5S)-5-[[3-[benzylsulfonyl(methyl)amino]benzoyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethyloctanoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 3-[[(2R,4S,5S)-5-[[3-[benzylsulfonyl(methyl)amino]benzoyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethyloctanoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142672256 |
| Molecular Formula | C39H61N3O7SSi |
| Molecular Weight | 744.08 g/mol |
| Exact Mass | 743.40 |
| IUPAC Name | methyl 3-[[(2R,4S,5S)-5-[[3-[benzylsulfonyl(methyl)amino]benzoyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethyloctanoyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCC(NC(=O)[C@H](C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC(C)C)NC(=O)c2cccc(N(C)S(=O)(=O)Cc3ccccc3)c2)C1 |
| InChI | InChI=1S/C39H61N3O7SSi/c1-27(2)22-34(41-37(44)30-18-15-21-33(25-30)42(7)50(46,47)26-29-16-12-11-13-17-29)35(49-51(9,10)39(4,5)6)23-28(3)36(43)40-32-20-14-19-31(24-32)38(45)48-8/h11-13,15-18,21,25,27-28,31-32,34-35H,14,19-20,22-24,26H2,1-10H3,(H,40,43)(H,41,44)/t28-,31?,32?,34+,35+/m1/s1 |
| InChIKey | MTLIXPSTVSZOLT-UZDHHTBASA-N |
| XLogP | 7.06 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.08 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|