C16H20F3N3O2S — CID 142672472
N-hydroxy-5-[1-[(6S)-7,7,7-trifluoro-6-methylheptyl]pyrazol-3-yl]thiophene-2-carboxamide (PubChem CID 142672472) has the molecular formula C16H20F3N3O2S and a molecular weight of 375.42 g/mol. Its IUPAC name is N-hydroxy-5-[1-[(6S)-7,7,7-trifluoro-6-methylheptyl]pyrazol-3-yl]thiophene-2-carboxamide.
| Compound Name | N-hydroxy-5-[1-[(6S)-7,7,7-trifluoro-6-methylheptyl]pyrazol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 142672472 |
| Molecular Formula | C16H20F3N3O2S |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-hydroxy-5-[1-[(6S)-7,7,7-trifluoro-6-methylheptyl]pyrazol-3-yl]thiophene-2-carboxamide |
| SMILES | C[C@@H](CCCCCn1ccc(-c2ccc(C(=O)NO)s2)n1)C(F)(F)F |
| InChI | InChI=1S/C16H20F3N3O2S/c1-11(16(17,18)19)5-3-2-4-9-22-10-8-12(20-22)13-6-7-14(25-13)15(23)21-24/h6-8,10-11,24H,2-5,9H2,1H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | KECHCDGENGCFBQ-NSHDSACASA-N |
| XLogP | 4.49 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|