C22H27N5O3S — CID 142858012
5-[1-[2-[[(2Z,4Z)-3-(butylideneamino)-4-ethenylhexa-2,4-dien-2-yl]amino]-2-oxoethyl]pyrazol-3-yl]-N-hydroxythiophene-2-carboxamide (PubChem CID 142858012) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is 5-[1-[2-[[(2Z,4Z)-3-(butylideneamino)-4-ethenylhexa-2,4-dien-2-yl]amino]-2-oxoethyl]pyrazol-3-yl]-N-hydroxythiophene-2-carboxamide.
| Compound Name | 5-[1-[2-[[(2Z,4Z)-3-(butylideneamino)-4-ethenylhexa-2,4-dien-2-yl]amino]-2-oxoethyl]pyrazol-3-yl]-N-hydroxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 142858012 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 5-[1-[2-[[(2Z,4Z)-3-(butylideneamino)-4-ethenylhexa-2,4-dien-2-yl]amino]-2-oxoethyl]pyrazol-3-yl]-N-hydroxythiophene-2-carboxamide |
| SMILES | C=C/C(=C/C)C(/N=C/CCC)=C(C)NC(=O)Cn1ccc(-c2ccc(C(=O)NO)s2)n1 |
| InChI | InChI=1S/C22H27N5O3S/c1-5-8-12-23-21(16(6-2)7-3)15(4)24-20(28)14-27-13-11-17(25-27)18-9-10-19(31-18)22(29)26-30/h6-7,9-13,30H,2,5,8,14H2,1,3-4H3,(H,24,28)(H,26,29)/b16-7-,21-15-,23-12+ |
| InChIKey | CIPLEDTZJFDHOT-LQSMAOMJSA-N |
| XLogP | 4.08 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|