C39H39N3O4Si — CID 142672572
N-[tert-butyl(dimethyl)silyl]oxy-4-[2-(9H-carbazol-2-yloxymethyl)-3-(naphthalen-1-ylamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 142672572) has the molecular formula C39H39N3O4Si and a molecular weight of 641.84 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]oxy-4-[2-(9H-carbazol-2-yloxymethyl)-3-(naphthalen-1-ylamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-[tert-butyl(dimethyl)silyl]oxy-4-[2-(9H-carbazol-2-yloxymethyl)-3-(naphthalen-1-ylamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 142672572 |
| Molecular Formula | C39H39N3O4Si |
| Molecular Weight | 641.84 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]oxy-4-[2-(9H-carbazol-2-yloxymethyl)-3-(naphthalen-1-ylamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)ONC(=O)c1ccc(C=C(COc2ccc3c(c2)[nH]c2ccccc23)C(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C39H39N3O4Si/c1-39(2,3)47(4,5)46-42-38(44)28-19-17-26(18-20-28)23-29(37(43)41-34-16-10-12-27-11-6-7-13-31(27)34)25-45-30-21-22-33-32-14-8-9-15-35(32)40-36(33)24-30/h6-24,40H,25H2,1-5H3,(H,41,43)(H,42,44) |
| InChIKey | TZKBCSVZUOFCNL-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.84 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|