C37H44N2O4Si — CID 142672502
4-[3-(4-tert-butylanilino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-[tert-butyl(dimethyl)silyl]oxybenzamide (PubChem CID 142672502) has the molecular formula C37H44N2O4Si and a molecular weight of 608.86 g/mol. Its IUPAC name is 4-[3-(4-tert-butylanilino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-[tert-butyl(dimethyl)silyl]oxybenzamide.
| Compound Name | 4-[3-(4-tert-butylanilino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-[tert-butyl(dimethyl)silyl]oxybenzamide |
|---|---|
| PubChem CID | 142672502 |
| Molecular Formula | C37H44N2O4Si |
| Molecular Weight | 608.86 g/mol |
| Exact Mass | 608.31 |
| IUPAC Name | 4-[3-(4-tert-butylanilino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-[tert-butyl(dimethyl)silyl]oxybenzamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)C(=Cc2ccc(C(=O)NO[Si](C)(C)C(C)(C)C)cc2)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C37H44N2O4Si/c1-36(2,3)30-20-22-31(23-21-30)38-34(40)29(25-42-33-15-11-13-27-12-9-10-14-32(27)33)24-26-16-18-28(19-17-26)35(41)39-43-44(7,8)37(4,5)6/h9-24H,25H2,1-8H3,(H,38,40)(H,39,41) |
| InChIKey | DKVOICOIPXMJEU-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.86 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|