C27H23NO5 — CID 66986986
methyl 4-[(E)-3-(furan-2-ylmethylamino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]benzoate (PubChem CID 66986986) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is methyl 4-[(E)-3-(furan-2-ylmethylamino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-(furan-2-ylmethylamino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 66986986 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | methyl 4-[(E)-3-(furan-2-ylmethylamino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\COc2cccc3ccccc23)C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C27H23NO5/c1-31-27(30)21-13-11-19(12-14-21)16-22(26(29)28-17-23-8-5-15-32-23)18-33-25-10-4-7-20-6-2-3-9-24(20)25/h2-16H,17-18H2,1H3,(H,28,29)/b22-16+ |
| InChIKey | LLJLKZHIYMZCLU-CJLVFECKSA-N |
| XLogP | 5.00 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|