C29H30N2O5 — CID 66987062
methyl 4-[(E)-2-(naphthalen-1-yloxymethyl)-3-oxo-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-1-enyl]benzoate (PubChem CID 66987062) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is methyl 4-[(E)-2-(naphthalen-1-yloxymethyl)-3-oxo-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-2-(naphthalen-1-yloxymethyl)-3-oxo-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 66987062 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | methyl 4-[(E)-2-(naphthalen-1-yloxymethyl)-3-oxo-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\COc2cccc3ccccc23)C(=O)NCCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C29H30N2O5/c1-35-29(34)23-14-12-21(13-15-23)19-24(28(33)30-16-6-18-31-17-5-11-27(31)32)20-36-26-10-4-8-22-7-2-3-9-25(22)26/h2-4,7-10,12-15,19H,5-6,11,16-18,20H2,1H3,(H,30,33)/b24-19+ |
| InChIKey | OKJIYMIFFGDYRM-LYBHJNIJSA-N |
| XLogP | 4.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|