C28H31NO3 — CID 140547254
methyl 4-[(Z)-2-[(cyclohexylamino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoate (PubChem CID 140547254) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is methyl 4-[(Z)-2-[(cyclohexylamino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(Z)-2-[(cyclohexylamino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 140547254 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | methyl 4-[(Z)-2-[(cyclohexylamino)methyl]-3-naphthalen-1-yloxyprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(/CNC2CCCCC2)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-31-28(30)24-16-14-21(15-17-24)18-22(19-29-25-10-3-2-4-11-25)20-32-27-13-7-9-23-8-5-6-12-26(23)27/h5-9,12-18,25,29H,2-4,10-11,19-20H2,1H3/b22-18- |
| InChIKey | UQYIATDLFIAXFS-PYCFMQQDSA-N |
| XLogP | 6.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |