C33H41N3O4 — CID 87225916
4-[(E)-2-[[(1-ethylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-(oxan-2-yloxy)benzamide (PubChem CID 87225916) has the molecular formula C33H41N3O4 and a molecular weight of 543.71 g/mol. Its IUPAC name is 4-[(E)-2-[[(1-ethylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-(oxan-2-yloxy)benzamide.
| Compound Name | 4-[(E)-2-[[(1-ethylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-(oxan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 87225916 |
| Molecular Formula | C33H41N3O4 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | 4-[(E)-2-[[(1-ethylpiperidin-4-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-(oxan-2-yloxy)benzamide |
| SMILES | CCN1CCC(NC/C(=C\c2ccc(C(=O)NOC3CCCCO3)cc2)COc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C33H41N3O4/c1-2-36-19-17-29(18-20-36)34-23-26(24-39-31-11-7-9-27-8-3-4-10-30(27)31)22-25-13-15-28(16-14-25)33(37)35-40-32-12-5-6-21-38-32/h3-4,7-11,13-16,22,29,32,34H,2,5-6,12,17-21,23-24H2,1H3,(H,35,37)/b26-22+ |
| InChIKey | QCUZAUWFFSXOGE-XTCLZLMSSA-N |
| XLogP | 5.56 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|