C30H34N2O6 — CID 91437056
4-[3-(1-methoxypropan-2-ylamino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-(oxan-2-yloxy)benzamide (PubChem CID 91437056) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is 4-[3-(1-methoxypropan-2-ylamino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-(oxan-2-yloxy)benzamide.
| Compound Name | 4-[3-(1-methoxypropan-2-ylamino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-(oxan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 91437056 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 4-[3-(1-methoxypropan-2-ylamino)-2-(naphthalen-1-yloxymethyl)-3-oxoprop-1-enyl]-N-(oxan-2-yloxy)benzamide |
| SMILES | COCC(C)NC(=O)C(=Cc1ccc(C(=O)NOC2CCCCO2)cc1)COc1cccc2ccccc12 |
| InChI | InChI=1S/C30H34N2O6/c1-21(19-35-2)31-29(33)25(20-37-27-11-7-9-23-8-3-4-10-26(23)27)18-22-13-15-24(16-14-22)30(34)32-38-28-12-5-6-17-36-28/h3-4,7-11,13-16,18,21,28H,5-6,12,17,19-20H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | JPODWODJCXQTPT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|