C37H41N3O4 — CID 87225943
4-[(E)-2-[[(1-benzylpyrrolidin-3-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-(oxan-2-yloxy)benzamide (PubChem CID 87225943) has the molecular formula C37H41N3O4 and a molecular weight of 591.75 g/mol. Its IUPAC name is 4-[(E)-2-[[(1-benzylpyrrolidin-3-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-(oxan-2-yloxy)benzamide.
| Compound Name | 4-[(E)-2-[[(1-benzylpyrrolidin-3-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-(oxan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 87225943 |
| Molecular Formula | C37H41N3O4 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | 4-[(E)-2-[[(1-benzylpyrrolidin-3-yl)amino]methyl]-3-naphthalen-1-yloxyprop-1-enyl]-N-(oxan-2-yloxy)benzamide |
| SMILES | O=C(NOC1CCCCO1)c1ccc(/C=C(\CNC2CCN(Cc3ccccc3)C2)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C37H41N3O4/c41-37(39-44-36-15-6-7-22-42-36)32-18-16-28(17-19-32)23-30(27-43-35-14-8-12-31-11-4-5-13-34(31)35)24-38-33-20-21-40(26-33)25-29-9-2-1-3-10-29/h1-5,8-14,16-19,23,33,36,38H,6-7,15,20-22,24-27H2,(H,39,41)/b30-23+ |
| InChIKey | XRVHOSLVHVRTAQ-JJKYIXSRSA-N |
| XLogP | 6.35 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|